C17H17F3N6O6 — CID 67047159
[2-[[5-nitro-4-(oxan-4-ylamino)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]carbamic acid (PubChem CID 67047159) has the molecular formula C17H17F3N6O6 and a molecular weight of 458.35 g/mol. Its IUPAC name is [2-[[5-nitro-4-(oxan-4-ylamino)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]carbamic acid.
| Compound Name | [2-[[5-nitro-4-(oxan-4-ylamino)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]carbamic acid |
|---|---|
| PubChem CID | 67047159 |
| Molecular Formula | C17H17F3N6O6 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [2-[[5-nitro-4-(oxan-4-ylamino)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(OC(F)(F)F)cc1Nc1ncc([N+](=O)[O-])c(NC2CCOCC2)n1 |
| InChI | InChI=1S/C17H17F3N6O6/c18-17(19,20)32-10-1-2-11(24-16(27)28)12(7-10)23-15-21-8-13(26(29)30)14(25-15)22-9-3-5-31-6-4-9/h1-2,7-9,24H,3-6H2,(H,27,28)(H2,21,22,23,25) |
| InChIKey | VONIXXYQBVGQGA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 160.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|