C17H14F3N3O4 — CID 8961424
4-(cyclopropylamino)-3-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 8961424) has the molecular formula C17H14F3N3O4 and a molecular weight of 381.31 g/mol. Its IUPAC name is 4-(cyclopropylamino)-3-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-(cyclopropylamino)-3-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 8961424 |
| Molecular Formula | C17H14F3N3O4 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-(cyclopropylamino)-3-nitro-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14F3N3O4/c18-17(19,20)27-13-6-4-12(5-7-13)22-16(24)10-1-8-14(21-11-2-3-11)15(9-10)23(25)26/h1,4-9,11,21H,2-3H2,(H,22,24) |
| InChIKey | OGMIUTIUFISSAQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|