C13H11F3N6O3 — CID 36579381
4-(cyclopropylamino)-3-nitro-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzamide (PubChem CID 36579381) has the molecular formula C13H11F3N6O3 and a molecular weight of 356.26 g/mol. Its IUPAC name is 4-(cyclopropylamino)-3-nitro-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 4-(cyclopropylamino)-3-nitro-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 36579381 |
| Molecular Formula | C13H11F3N6O3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-(cyclopropylamino)-3-nitro-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzamide |
| SMILES | O=C(Nc1n[nH]c(C(F)(F)F)n1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11F3N6O3/c14-13(15,16)11-19-12(21-20-11)18-10(23)6-1-4-8(17-7-2-3-7)9(5-6)22(24)25/h1,4-5,7,17H,2-3H2,(H2,18,19,20,21,23) |
| InChIKey | LVUCXTDXWQVWQV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|