C24H24F2N6O5 — CID 66970500
tert-butyl N-[4-fluoro-2-[[4-[[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]amino]-5-nitropyrimidin-2-yl]amino]phenyl]carbamate (PubChem CID 66970500) has the molecular formula C24H24F2N6O5 and a molecular weight of 514.49 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-2-[[4-[[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]amino]-5-nitropyrimidin-2-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-2-[[4-[[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]amino]-5-nitropyrimidin-2-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 66970500 |
| Molecular Formula | C24H24F2N6O5 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | tert-butyl N-[4-fluoro-2-[[4-[[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]amino]-5-nitropyrimidin-2-yl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)cc1Nc1ncc([N+](=O)[O-])c(N[C@@H]2CCOc3c(F)cccc32)n1 |
| InChI | InChI=1S/C24H24F2N6O5/c1-24(2,3)37-23(33)30-17-8-7-13(25)11-18(17)29-22-27-12-19(32(34)35)21(31-22)28-16-9-10-36-20-14(16)5-4-6-15(20)26/h4-8,11-12,16H,9-10H2,1-3H3,(H,30,33)(H2,27,28,29,31)/t16-/m1/s1 |
| InChIKey | CVARZKZDGOMDTI-MRXNPFEDSA-N |
| XLogP | 5.69 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|