C17H15F3N6O4S — CID 59704958
tert-butyl N-[2-[(5-nitro-4-thiocyanatopyrimidin-2-yl)amino]-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 59704958) has the molecular formula C17H15F3N6O4S and a molecular weight of 456.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-nitro-4-thiocyanatopyrimidin-2-yl)amino]-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-nitro-4-thiocyanatopyrimidin-2-yl)amino]-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 59704958 |
| Molecular Formula | C17H15F3N6O4S |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | tert-butyl N-[2-[(5-nitro-4-thiocyanatopyrimidin-2-yl)amino]-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(F)(F)F)cc1Nc1ncc([N+](=O)[O-])c(SC#N)n1 |
| InChI | InChI=1S/C17H15F3N6O4S/c1-16(2,3)30-15(27)24-10-5-4-9(17(18,19)20)6-11(10)23-14-22-7-12(26(28)29)13(25-14)31-8-21/h4-7H,1-3H3,(H,24,27)(H,22,23,25) |
| InChIKey | CABRTZDWEPXVRB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 143.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|