C11H8N6O2S — CID 121224481
[5-nitro-2-(2-phenylhydrazinyl)pyrimidin-4-yl] thiocyanate (PubChem CID 121224481) has the molecular formula C11H8N6O2S and a molecular weight of 288.29 g/mol. Its IUPAC name is [5-nitro-2-(2-phenylhydrazinyl)pyrimidin-4-yl] thiocyanate.
| Compound Name | [5-nitro-2-(2-phenylhydrazinyl)pyrimidin-4-yl] thiocyanate |
|---|---|
| PubChem CID | 121224481 |
| Molecular Formula | C11H8N6O2S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | [5-nitro-2-(2-phenylhydrazinyl)pyrimidin-4-yl] thiocyanate |
| SMILES | N#CSc1nc(NNc2ccccc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8N6O2S/c12-7-20-10-9(17(18)19)6-13-11(14-10)16-15-8-4-2-1-3-5-8/h1-6,15H,(H,13,14,16) |
| InChIKey | BUECDOSOBUOJEH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|