C24H13ClN12O4S2 — CID 158470279
1H-benzimidazole;[2-(benzimidazol-1-yl)-5-nitropyrimidin-4-yl] thiocyanate;(2-chloro-5-nitropyrimidin-4-yl) thiocyanate (PubChem CID 158470279) has the molecular formula C24H13ClN12O4S2 and a molecular weight of 633.04 g/mol. Its IUPAC name is 1H-benzimidazole;[2-(benzimidazol-1-yl)-5-nitropyrimidin-4-yl] thiocyanate;(2-chloro-5-nitropyrimidin-4-yl) thiocyanate.
| Compound Name | 1H-benzimidazole;[2-(benzimidazol-1-yl)-5-nitropyrimidin-4-yl] thiocyanate;(2-chloro-5-nitropyrimidin-4-yl) thiocyanate |
|---|---|
| PubChem CID | 158470279 |
| Molecular Formula | C24H13ClN12O4S2 |
| Molecular Weight | 633.04 g/mol |
| Exact Mass | 632.03 |
| IUPAC Name | 1H-benzimidazole;[2-(benzimidazol-1-yl)-5-nitropyrimidin-4-yl] thiocyanate;(2-chloro-5-nitropyrimidin-4-yl) thiocyanate |
| SMILES | N#CSc1nc(-n2cnc3ccccc32)ncc1[N+](=O)[O-].N#CSc1nc(Cl)ncc1[N+](=O)[O-].c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C12H6N6O2S.C7H6N2.C5HClN4O2S/c13-6-21-11-10(18(19)20)5-14-12(16-11)17-7-15-8-3-1-2-4-9(8)17;1-2-4-7-6(3-1)8-5-9-7;6-5-8-1-3(10(11)12)4(9-5)13-2-7/h1-5,7H;1-5H,(H,8,9);1H |
| InChIKey | HGGNYFZTHLGOFF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 231.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.04 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|