C12H12N4O3 — CID 121013586
4-ethoxy-5-nitro-N-phenylpyrimidin-2-amine (PubChem CID 121013586) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 4-ethoxy-5-nitro-N-phenylpyrimidin-2-amine.
| Compound Name | 4-ethoxy-5-nitro-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 121013586 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 4-ethoxy-5-nitro-N-phenylpyrimidin-2-amine |
| SMILES | CCOc1nc(Nc2ccccc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O3/c1-2-19-11-10(16(17)18)8-13-12(15-11)14-9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,13,14,15) |
| InChIKey | LHBIYENHBLCISG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|