C10H9N3O3 — CID 12857736
2-ethoxy-3-nitro-1,8-naphthyridine (PubChem CID 12857736) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-ethoxy-3-nitro-1,8-naphthyridine.
| Compound Name | 2-ethoxy-3-nitro-1,8-naphthyridine |
|---|---|
| PubChem CID | 12857736 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-ethoxy-3-nitro-1,8-naphthyridine |
| SMILES | CCOc1nc2ncccc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N3O3/c1-2-16-10-8(13(14)15)6-7-4-3-5-11-9(7)12-10/h3-6H,2H2,1H3 |
| InChIKey | XTMVDRVDDGEUCW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|