C20H20N6O4 — CID 21081000
4-[[4-[2-hydroxyethyl(methyl)amino]-5-nitropyrimidin-2-yl]amino]-N-phenylbenzamide (PubChem CID 21081000) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is 4-[[4-[2-hydroxyethyl(methyl)amino]-5-nitropyrimidin-2-yl]amino]-N-phenylbenzamide.
| Compound Name | 4-[[4-[2-hydroxyethyl(methyl)amino]-5-nitropyrimidin-2-yl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 21081000 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-[[4-[2-hydroxyethyl(methyl)amino]-5-nitropyrimidin-2-yl]amino]-N-phenylbenzamide |
| SMILES | CN(CCO)c1nc(Nc2ccc(C(=O)Nc3ccccc3)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N6O4/c1-25(11-12-27)18-17(26(29)30)13-21-20(24-18)23-16-9-7-14(8-10-16)19(28)22-15-5-3-2-4-6-15/h2-10,13,27H,11-12H2,1H3,(H,22,28)(H,21,23,24) |
| InChIKey | FCKRJOUJUVPUCF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|