C13H17N5O — CID 67518527
2-[(4-anilino-6-methyl-1,3,5-triazin-2-yl)-methylamino]ethanol (PubChem CID 67518527) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[(4-anilino-6-methyl-1,3,5-triazin-2-yl)-methylamino]ethanol.
| Compound Name | 2-[(4-anilino-6-methyl-1,3,5-triazin-2-yl)-methylamino]ethanol |
|---|---|
| PubChem CID | 67518527 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-[(4-anilino-6-methyl-1,3,5-triazin-2-yl)-methylamino]ethanol |
| SMILES | Cc1nc(Nc2ccccc2)nc(N(C)CCO)n1 |
| InChI | InChI=1S/C13H17N5O/c1-10-14-12(16-11-6-4-3-5-7-11)17-13(15-10)18(2)8-9-19/h3-7,19H,8-9H2,1-2H3,(H,14,15,16,17) |
| InChIKey | FBFILXXIIMJNTJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |