C15H21N5O — CID 10708431
2-[(4-anilino-6-methyl-1,3,5-triazin-2-yl)amino]pentan-1-ol (PubChem CID 10708431) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-[(4-anilino-6-methyl-1,3,5-triazin-2-yl)amino]pentan-1-ol.
| Compound Name | 2-[(4-anilino-6-methyl-1,3,5-triazin-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 10708431 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[(4-anilino-6-methyl-1,3,5-triazin-2-yl)amino]pentan-1-ol |
| SMILES | CCCC(CO)Nc1nc(C)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H21N5O/c1-3-7-13(10-21)19-15-17-11(2)16-14(20-15)18-12-8-5-4-6-9-12/h4-6,8-9,13,21H,3,7,10H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | JOZHYFVTOWFRCX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |