C20H31N5O — CID 10737065
2-[[4-(2,6-diethylanilino)-6-methyl-1,3,5-triazin-2-yl]amino]hexan-1-ol (PubChem CID 10737065) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-[[4-(2,6-diethylanilino)-6-methyl-1,3,5-triazin-2-yl]amino]hexan-1-ol.
| Compound Name | 2-[[4-(2,6-diethylanilino)-6-methyl-1,3,5-triazin-2-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 10737065 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 2-[[4-(2,6-diethylanilino)-6-methyl-1,3,5-triazin-2-yl]amino]hexan-1-ol |
| SMILES | CCCCC(CO)Nc1nc(C)nc(Nc2c(CC)cccc2CC)n1 |
| InChI | InChI=1S/C20H31N5O/c1-5-8-12-17(13-26)23-19-21-14(4)22-20(25-19)24-18-15(6-2)10-9-11-16(18)7-3/h9-11,17,26H,5-8,12-13H2,1-4H3,(H2,21,22,23,24,25) |
| InChIKey | QQJSVHSXHGGIFI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |