C12H16N6O — CID 141026020
2-[(4-amino-6-anilino-1,3,5-triazin-2-yl)amino]propan-1-ol (PubChem CID 141026020) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-[(4-amino-6-anilino-1,3,5-triazin-2-yl)amino]propan-1-ol.
| Compound Name | 2-[(4-amino-6-anilino-1,3,5-triazin-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 141026020 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-[(4-amino-6-anilino-1,3,5-triazin-2-yl)amino]propan-1-ol |
| SMILES | CC(CO)Nc1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C12H16N6O/c1-8(7-19)14-11-16-10(13)17-12(18-11)15-9-5-3-2-4-6-9/h2-6,8,19H,7H2,1H3,(H4,13,14,15,16,17,18) |
| InChIKey | HWUHSNWNSRHVFJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |