C38H42N12O8S2 — CID 154446622
6-[1,2-bis[[4-anilino-6-(1-hydroxypropan-2-ylamino)-1,3,5-triazin-2-yl]amino]-2-phenylethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid (PubChem CID 154446622) has the molecular formula C38H42N12O8S2 and a molecular weight of 858.96 g/mol. Its IUPAC name is 6-[1,2-bis[[4-anilino-6-(1-hydroxypropan-2-ylamino)-1,3,5-triazin-2-yl]amino]-2-phenylethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid.
| Compound Name | 6-[1,2-bis[[4-anilino-6-(1-hydroxypropan-2-ylamino)-1,3,5-triazin-2-yl]amino]-2-phenylethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid |
|---|---|
| PubChem CID | 154446622 |
| Molecular Formula | C38H42N12O8S2 |
| Molecular Weight | 858.96 g/mol |
| Exact Mass | 858.27 |
| IUPAC Name | 6-[1,2-bis[[4-anilino-6-(1-hydroxypropan-2-ylamino)-1,3,5-triazin-2-yl]amino]-2-phenylethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid |
| SMILES | CC(CO)Nc1nc(NC(=C(Nc2nc(Nc3ccccc3)nc(NC(C)CO)n2)C2C=CC=CC2(S(=O)(=O)O)S(=O)(=O)O)c2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C38H42N12O8S2/c1-24(22-51)39-32-45-34(41-27-16-8-4-9-17-27)49-36(47-32)43-30(26-14-6-3-7-15-26)31(29-20-12-13-21-38(29,59(53,54)55)60(56,57)58)44-37-48-33(40-25(2)23-52)46-35(50-37)42-28-18-10-5-11-19-28/h3-21,24-25,29,51-52H,22-23H2,1-2H3,(H,53,54,55)(H,56,57,58)(H3,39,41,43,45,47,49)(H3,40,42,44,46,48,50) |
| InChIKey | LSVFJFAWGYSJES-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 298.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|