C17H17BrN6 — CID 25329937
6-[(1S)-1-(4-bromoanilino)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 25329937) has the molecular formula C17H17BrN6 and a molecular weight of 385.27 g/mol. Its IUPAC name is 6-[(1S)-1-(4-bromoanilino)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(1S)-1-(4-bromoanilino)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 25329937 |
| Molecular Formula | C17H17BrN6 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 6-[(1S)-1-(4-bromoanilino)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@H](Nc1ccc(Br)cc1)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H17BrN6/c1-11(20-14-9-7-12(18)8-10-14)15-22-16(19)24-17(23-15)21-13-5-3-2-4-6-13/h2-11,20H,1H3,(H3,19,21,22,23,24)/t11-/m0/s1 |
| InChIKey | BYXDBKGYESTUPY-NSHDSACASA-N |
| XLogP | 4.13 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |