C20H23N5OS — CID 41016265
6-[(1S)-1-(3-phenoxypropylsulfanyl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 41016265) has the molecular formula C20H23N5OS and a molecular weight of 381.50 g/mol. Its IUPAC name is 6-[(1S)-1-(3-phenoxypropylsulfanyl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(1S)-1-(3-phenoxypropylsulfanyl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 41016265 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 6-[(1S)-1-(3-phenoxypropylsulfanyl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@H](SCCCOc1ccccc1)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H23N5OS/c1-15(27-14-8-13-26-17-11-6-3-7-12-17)18-23-19(21)25-20(24-18)22-16-9-4-2-5-10-16/h2-7,9-12,15H,8,13-14H2,1H3,(H3,21,22,23,24,25)/t15-/m0/s1 |
| InChIKey | ZZEIYNAXUOZPHT-HNNXBMFYSA-N |
| XLogP | 4.46 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|