C17H17ClN6S — CID 98677477
6-[(1S)-1-[(6-chloro-3-pyridinyl)methylsulfanyl]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 98677477) has the molecular formula C17H17ClN6S and a molecular weight of 372.89 g/mol. Its IUPAC name is 6-[(1S)-1-[(6-chloro-3-pyridinyl)methylsulfanyl]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(1S)-1-[(6-chloro-3-pyridinyl)methylsulfanyl]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 98677477 |
| Molecular Formula | C17H17ClN6S |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 6-[(1S)-1-[(6-chloro-3-pyridinyl)methylsulfanyl]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@H](SCc1ccc(Cl)nc1)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H17ClN6S/c1-11(25-10-12-7-8-14(18)20-9-12)15-22-16(19)24-17(23-15)21-13-5-3-2-4-6-13/h2-9,11H,10H2,1H3,(H3,19,21,22,23,24)/t11-/m0/s1 |
| InChIKey | FOGSBBLHYUHJMQ-NSHDSACASA-N |
| XLogP | 4.24 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|