C17H16N8S — CID 9454040
2-N-phenyl-6-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 9454040) has the molecular formula C17H16N8S and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-N-phenyl-6-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-phenyl-6-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 9454040 |
| Molecular Formula | C17H16N8S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-N-phenyl-6-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Sc1nnc2ccccn12)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H16N8S/c1-11(26-17-24-23-13-9-5-6-10-25(13)17)14-20-15(18)22-16(21-14)19-12-7-3-2-4-8-12/h2-11H,1H3,(H3,18,19,20,21,22)/t11-/m1/s1 |
| InChIKey | STEDZVOFNYJFFZ-LLVKDONJSA-N |
| XLogP | 3.09 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |