C17H24N6 — CID 42925988
6-[1-(azepan-1-yl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 42925988) has the molecular formula C17H24N6 and a molecular weight of 312.42 g/mol. Its IUPAC name is 6-[1-(azepan-1-yl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-(azepan-1-yl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42925988 |
| Molecular Formula | C17H24N6 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 6-[1-(azepan-1-yl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(c1nc(N)nc(Nc2ccccc2)n1)N1CCCCCC1 |
| InChI | InChI=1S/C17H24N6/c1-13(23-11-7-2-3-8-12-23)15-20-16(18)22-17(21-15)19-14-9-5-4-6-10-14/h4-6,9-10,13H,2-3,7-8,11-12H2,1H3,(H3,18,19,20,21,22) |
| InChIKey | ROQANUXUILPOLO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |