C18H20N6S — CID 30765842
6-[(1S)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 30765842) has the molecular formula C18H20N6S and a molecular weight of 352.47 g/mol. Its IUPAC name is 6-[(1S)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(1S)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 30765842 |
| Molecular Formula | C18H20N6S |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 6-[(1S)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](c1nc(N)nc(Nc2ccccc2)n1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C18H20N6S/c1-12(24-9-7-15-13(11-24)8-10-25-15)16-21-17(19)23-18(22-16)20-14-5-3-2-4-6-14/h2-6,8,10,12H,7,9,11H2,1H3,(H3,19,20,21,22,23)/t12-/m0/s1 |
| InChIKey | FUCFJEJFKGPKNA-LBPRGKRZSA-N |
| XLogP | 3.38 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |