C21H25N5OS — CID 18229181
6-[1-[2-(2,5-dimethylphenoxy)ethylsulfanyl]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 18229181) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 6-[1-[2-(2,5-dimethylphenoxy)ethylsulfanyl]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[2-(2,5-dimethylphenoxy)ethylsulfanyl]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 18229181 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 6-[1-[2-(2,5-dimethylphenoxy)ethylsulfanyl]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(C)c(OCCSC(C)c2nc(N)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H25N5OS/c1-14-9-10-15(2)18(13-14)27-11-12-28-16(3)19-24-20(22)26-21(25-19)23-17-7-5-4-6-8-17/h4-10,13,16H,11-12H2,1-3H3,(H3,22,23,24,25,26) |
| InChIKey | UBAWTFPDVIDSMY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|