C19H17Cl3N6OS — CID 41259748
2-[(1R)-1-(4-amino-6-anilino-1,3,5-triazin-2-yl)ethyl]sulfanyl-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 41259748) has the molecular formula C19H17Cl3N6OS and a molecular weight of 483.81 g/mol. Its IUPAC name is 2-[(1R)-1-(4-amino-6-anilino-1,3,5-triazin-2-yl)ethyl]sulfanyl-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(1R)-1-(4-amino-6-anilino-1,3,5-triazin-2-yl)ethyl]sulfanyl-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 41259748 |
| Molecular Formula | C19H17Cl3N6OS |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 2-[(1R)-1-(4-amino-6-anilino-1,3,5-triazin-2-yl)ethyl]sulfanyl-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C[C@@H](SCC(=O)Nc1cc(Cl)c(Cl)cc1Cl)c1nc(N)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C19H17Cl3N6OS/c1-10(30-9-16(29)25-15-8-13(21)12(20)7-14(15)22)17-26-18(23)28-19(27-17)24-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,25,29)(H3,23,24,26,27,28)/t10-/m1/s1 |
| InChIKey | UCOJELWUHWUUFS-SNVBAGLBSA-N |
| XLogP | 5.59 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|