C19H20FN5OS — CID 17391813
2-N-(4-fluorophenyl)-6-(3-phenoxypropylsulfanylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 17391813) has the molecular formula C19H20FN5OS and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-6-(3-phenoxypropylsulfanylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-fluorophenyl)-6-(3-phenoxypropylsulfanylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 17391813 |
| Molecular Formula | C19H20FN5OS |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-N-(4-fluorophenyl)-6-(3-phenoxypropylsulfanylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CSCCCOc2ccccc2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H20FN5OS/c20-14-7-9-15(10-8-14)22-19-24-17(23-18(21)25-19)13-27-12-4-11-26-16-5-2-1-3-6-16/h1-3,5-10H,4,11-13H2,(H3,21,22,23,24,25) |
| InChIKey | HPXJNLHNKCYWAJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|