C20H17ClN6O2 — CID 21080966
3-[benzyl-[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]propanenitrile (PubChem CID 21080966) has the molecular formula C20H17ClN6O2 and a molecular weight of 408.85 g/mol. Its IUPAC name is 3-[benzyl-[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[benzyl-[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 21080966 |
| Molecular Formula | C20H17ClN6O2 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 3-[benzyl-[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]amino]propanenitrile |
| SMILES | N#CCCN(Cc1ccccc1)c1nc(Nc2ccc(Cl)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17ClN6O2/c21-16-7-9-17(10-8-16)24-20-23-13-18(27(28)29)19(25-20)26(12-4-11-22)14-15-5-2-1-3-6-15/h1-3,5-10,13H,4,12,14H2,(H,23,24,25) |
| InChIKey | ALEOWJXMWCTLMA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|