C19H16ClN7O2 — CID 21080749
4-N-(1H-benzimidazol-2-yl)-2-N-(4-chlorophenyl)-4-N-ethyl-5-nitropyrimidine-2,4-diamine (PubChem CID 21080749) has the molecular formula C19H16ClN7O2 and a molecular weight of 409.84 g/mol. Its IUPAC name is 4-N-(1H-benzimidazol-2-yl)-2-N-(4-chlorophenyl)-4-N-ethyl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-benzimidazol-2-yl)-2-N-(4-chlorophenyl)-4-N-ethyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21080749 |
| Molecular Formula | C19H16ClN7O2 |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-N-(1H-benzimidazol-2-yl)-2-N-(4-chlorophenyl)-4-N-ethyl-5-nitropyrimidine-2,4-diamine |
| SMILES | CCN(c1nc2ccccc2[nH]1)c1nc(Nc2ccc(Cl)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16ClN7O2/c1-2-26(19-23-14-5-3-4-6-15(14)24-19)17-16(27(28)29)11-21-18(25-17)22-13-9-7-12(20)8-10-13/h3-11H,2H2,1H3,(H,23,24)(H,21,22,25) |
| InChIKey | RZRPYRZDBJFBBH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|