C20H18ClN7O3 — CID 67210252
5-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]-methylamino]-1,3-dihydroisoindole-2-carboxamide (PubChem CID 67210252) has the molecular formula C20H18ClN7O3 and a molecular weight of 439.86 g/mol. Its IUPAC name is 5-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]-methylamino]-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | 5-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]-methylamino]-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 67210252 |
| Molecular Formula | C20H18ClN7O3 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 5-[[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]-methylamino]-1,3-dihydroisoindole-2-carboxamide |
| SMILES | CN(c1ccc2c(c1)CN(C(N)=O)C2)c1nc(Nc2ccc(Cl)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18ClN7O3/c1-26(16-7-2-12-10-27(19(22)29)11-13(12)8-16)18-17(28(30)31)9-23-20(25-18)24-15-5-3-14(21)4-6-15/h2-9H,10-11H2,1H3,(H2,22,29)(H,23,24,25) |
| InChIKey | WFHKZMRKADQBPF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|