C29H29ClN6O4 — CID 21080911
4-[4-[bis(4-methoxyphenyl)methyl]piperazin-1-yl]-N-(4-chlorophenyl)-5-nitropyrimidin-2-amine (PubChem CID 21080911) has the molecular formula C29H29ClN6O4 and a molecular weight of 561.04 g/mol. Its IUPAC name is 4-[4-[bis(4-methoxyphenyl)methyl]piperazin-1-yl]-N-(4-chlorophenyl)-5-nitropyrimidin-2-amine.
| Compound Name | 4-[4-[bis(4-methoxyphenyl)methyl]piperazin-1-yl]-N-(4-chlorophenyl)-5-nitropyrimidin-2-amine |
|---|---|
| PubChem CID | 21080911 |
| Molecular Formula | C29H29ClN6O4 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 4-[4-[bis(4-methoxyphenyl)methyl]piperazin-1-yl]-N-(4-chlorophenyl)-5-nitropyrimidin-2-amine |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)N2CCN(c3nc(Nc4ccc(Cl)cc4)ncc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C29H29ClN6O4/c1-39-24-11-3-20(4-12-24)27(21-5-13-25(40-2)14-6-21)34-15-17-35(18-16-34)28-26(36(37)38)19-31-29(33-28)32-23-9-7-22(30)8-10-23/h3-14,19,27H,15-18H2,1-2H3,(H,31,32,33) |
| InChIKey | QYURNLPIPNWIAW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|