C26H34F6N6O — CID 87535417
2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 87535417) has the molecular formula C26H34F6N6O and a molecular weight of 560.59 g/mol. Its IUPAC name is 2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87535417 |
| Molecular Formula | C26H34F6N6O |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(N4CCOCC4)c(C(F)(F)F)c3)ncc2C(F)(F)F)CC1(C)C |
| InChI | InChI=1S/C26H34F6N6O/c1-23(2)13-17(14-24(3,4)37(23)5)34-21-19(26(30,31)32)15-33-22(36-21)35-16-6-7-20(18(12-16)25(27,28)29)38-8-10-39-11-9-38/h6-7,12,15,17H,8-11,13-14H2,1-5H3,(H2,33,34,35,36) |
| InChIKey | JZRARMZADPNMCY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|