C32H40F4N6O — CID 68664484
4-N-benzyl-5-fluoro-2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68664484) has the molecular formula C32H40F4N6O and a molecular weight of 600.71 g/mol. Its IUPAC name is 4-N-benzyl-5-fluoro-2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-5-fluoro-2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68664484 |
| Molecular Formula | C32H40F4N6O |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | 4-N-benzyl-5-fluoro-2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(N(Cc2ccccc2)c2nc(Nc3ccc(N4CCOCC4)c(C(F)(F)F)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C32H40F4N6O/c1-30(2)18-24(19-31(3,4)40(30)5)42(21-22-9-7-6-8-10-22)28-26(33)20-37-29(39-28)38-23-11-12-27(25(17-23)32(34,35)36)41-13-15-43-16-14-41/h6-12,17,20,24H,13-16,18-19,21H2,1-5H3,(H,37,38,39) |
| InChIKey | VNIXHDLPMKRXSR-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|