C23H24F3N5O — CID 117086891
5-methyl-2-N-(4-morpholin-4-ylphenyl)-4-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 117086891) has the molecular formula C23H24F3N5O and a molecular weight of 443.47 g/mol. Its IUPAC name is 5-methyl-2-N-(4-morpholin-4-ylphenyl)-4-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-2-N-(4-morpholin-4-ylphenyl)-4-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 117086891 |
| Molecular Formula | C23H24F3N5O |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 5-methyl-2-N-(4-morpholin-4-ylphenyl)-4-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F3N5O/c1-16-14-28-22(29-19-5-7-20(8-6-19)31-9-11-32-12-10-31)30-21(16)27-15-17-3-2-4-18(13-17)23(24,25)26/h2-8,13-14H,9-12,15H2,1H3,(H2,27,28,29,30) |
| InChIKey | CXWPZBDFZQVBDP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|