C22H20ClF4N5O2 — CID 67277131
4-N-(3-chloro-4-morpholin-4-ylphenyl)-5-fluoro-2-N-[3-methoxy-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 67277131) has the molecular formula C22H20ClF4N5O2 and a molecular weight of 497.88 g/mol. Its IUPAC name is 4-N-(3-chloro-4-morpholin-4-ylphenyl)-5-fluoro-2-N-[3-methoxy-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-chloro-4-morpholin-4-ylphenyl)-5-fluoro-2-N-[3-methoxy-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67277131 |
| Molecular Formula | C22H20ClF4N5O2 |
| Molecular Weight | 497.88 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-N-(3-chloro-4-morpholin-4-ylphenyl)-5-fluoro-2-N-[3-methoxy-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3ccc(N4CCOCC4)c(Cl)c3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20ClF4N5O2/c1-33-16-9-13(22(25,26)27)8-15(10-16)30-21-28-12-18(24)20(31-21)29-14-2-3-19(17(23)11-14)32-4-6-34-7-5-32/h2-3,8-12H,4-7H2,1H3,(H2,28,29,30,31) |
| InChIKey | IALOSETWMJSIEH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|