C18H13F7N6 — CID 22060956
2-N,4-N-bis[3-amino-5-(trifluoromethyl)phenyl]-5-fluoropyrimidine-2,4-diamine (PubChem CID 22060956) has the molecular formula C18H13F7N6 and a molecular weight of 446.33 g/mol. Its IUPAC name is 2-N,4-N-bis[3-amino-5-(trifluoromethyl)phenyl]-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[3-amino-5-(trifluoromethyl)phenyl]-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22060956 |
| Molecular Formula | C18H13F7N6 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-N,4-N-bis[3-amino-5-(trifluoromethyl)phenyl]-5-fluoropyrimidine-2,4-diamine |
| SMILES | Nc1cc(Nc2ncc(F)c(Nc3cc(N)cc(C(F)(F)F)c3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F7N6/c19-14-7-28-16(30-13-4-9(18(23,24)25)2-11(27)6-13)31-15(14)29-12-3-8(17(20,21)22)1-10(26)5-12/h1-7H,26-27H2,(H2,28,29,30,31) |
| InChIKey | RSIPGYLRIGVZLN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|