C30H42FN7O2 — CID 67144645
[2-(2,5-dimethylpyrrol-1-yl)-4-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl] N-propan-2-ylcarbamate (PubChem CID 67144645) has the molecular formula C30H42FN7O2 and a molecular weight of 551.71 g/mol. Its IUPAC name is [2-(2,5-dimethylpyrrol-1-yl)-4-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl] N-propan-2-ylcarbamate.
| Compound Name | [2-(2,5-dimethylpyrrol-1-yl)-4-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 67144645 |
| Molecular Formula | C30H42FN7O2 |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | [2-(2,5-dimethylpyrrol-1-yl)-4-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl] N-propan-2-ylcarbamate |
| SMILES | Cc1ccc(C)n1-c1cc(Nc2ncc(F)c(NC3CC(C)(C)N(C)C(C)(C)C3)n2)ccc1OC(=O)NC(C)C |
| InChI | InChI=1S/C30H42FN7O2/c1-18(2)33-28(39)40-25-13-12-21(14-24(25)38-19(3)10-11-20(38)4)35-27-32-17-23(31)26(36-27)34-22-15-29(5,6)37(9)30(7,8)16-22/h10-14,17-18,22H,15-16H2,1-9H3,(H,33,39)(H2,32,34,35,36) |
| InChIKey | KRJDZLDXZLUSOK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|