C25H36FN9O — CID 68665078
5-fluoro-2-N-[4-methoxy-3-(5-propyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665078) has the molecular formula C25H36FN9O and a molecular weight of 497.62 g/mol. Its IUPAC name is 5-fluoro-2-N-[4-methoxy-3-(5-propyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[4-methoxy-3-(5-propyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665078 |
| Molecular Formula | C25H36FN9O |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 5-fluoro-2-N-[4-methoxy-3-(5-propyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CCCc1nnnn1-c1cc(Nc2ncc(F)c(NC3CC(C)(C)N(C)C(C)(C)C3)n2)ccc1OC |
| InChI | InChI=1S/C25H36FN9O/c1-8-9-21-31-32-33-35(21)19-12-16(10-11-20(19)36-7)29-23-27-15-18(26)22(30-23)28-17-13-24(2,3)34(6)25(4,5)14-17/h10-12,15,17H,8-9,13-14H2,1-7H3,(H2,27,28,29,30) |
| InChIKey | RKZADQUDAXOBCH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |