C22H30FN9S — CID 68665794
5-fluoro-2-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665794) has the molecular formula C22H30FN9S and a molecular weight of 471.61 g/mol. Its IUPAC name is 5-fluoro-2-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665794 |
| Molecular Formula | C22H30FN9S |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 5-fluoro-2-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CSc1nnnn1-c1cccc(Nc2ncc(F)c(NC3CC(C)(C)N(C)C(C)(C)C3)n2)c1 |
| InChI | InChI=1S/C22H30FN9S/c1-21(2)11-15(12-22(3,4)31(21)5)25-18-17(23)13-24-19(27-18)26-14-8-7-9-16(10-14)32-20(33-6)28-29-30-32/h7-10,13,15H,11-12H2,1-6H3,(H2,24,25,26,27) |
| InChIKey | CKMHQAUWYOFYBA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |