C17H26FN7S2 — CID 68665924
5-fluoro-2-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665924) has the molecular formula C17H26FN7S2 and a molecular weight of 411.58 g/mol. Its IUPAC name is 5-fluoro-2-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665924 |
| Molecular Formula | C17H26FN7S2 |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 5-fluoro-2-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CSc1nnc(Nc2ncc(F)c(NC3CC(C)(C)N(C)C(C)(C)C3)n2)s1 |
| InChI | InChI=1S/C17H26FN7S2/c1-16(2)7-10(8-17(3,4)25(16)5)20-12-11(18)9-19-13(21-12)22-14-23-24-15(26-6)27-14/h9-10H,7-8H2,1-6H3,(H2,19,20,21,22,23) |
| InChIKey | HBFHLWVRWZMMTI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |