C24H29F3N10S — CID 67144895
4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-2-[3-[5-(2,2,2-trifluoroethylsulfanyl)tetrazol-1-yl]anilino]pyrimidine-5-carbonitrile (PubChem CID 67144895) has the molecular formula C24H29F3N10S and a molecular weight of 546.63 g/mol. Its IUPAC name is 4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-2-[3-[5-(2,2,2-trifluoroethylsulfanyl)tetrazol-1-yl]anilino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-2-[3-[5-(2,2,2-trifluoroethylsulfanyl)tetrazol-1-yl]anilino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 67144895 |
| Molecular Formula | C24H29F3N10S |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-2-[3-[5-(2,2,2-trifluoroethylsulfanyl)tetrazol-1-yl]anilino]pyrimidine-5-carbonitrile |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3cccc(-n4nnnc4SCC(F)(F)F)c3)ncc2C#N)CC1(C)C |
| InChI | InChI=1S/C24H29F3N10S/c1-22(2)10-17(11-23(3,4)36(22)5)30-19-15(12-28)13-29-20(32-19)31-16-7-6-8-18(9-16)37-21(33-34-35-37)38-14-24(25,26)27/h6-9,13,17H,10-11,14H2,1-5H3,(H2,29,30,31,32) |
| InChIKey | JTMPTRSTLPGBIR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |