C28H39N7O2 — CID 68665841
2-[(2,2-dimethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-7-yl)amino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidine-5-carbonitrile (PubChem CID 68665841) has the molecular formula C28H39N7O2 and a molecular weight of 505.67 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-7-yl)amino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 2-[(2,2-dimethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-7-yl)amino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 68665841 |
| Molecular Formula | C28H39N7O2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 2-[(2,2-dimethyl-3-oxo-4-propan-2-yl-1,4-benzoxazin-7-yl)amino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidine-5-carbonitrile |
| SMILES | CC(C)N1C(=O)C(C)(C)Oc2cc(Nc3ncc(C#N)c(NC4CC(C)(C)N(C)C(C)(C)C4)n3)ccc21 |
| InChI | InChI=1S/C28H39N7O2/c1-17(2)35-21-11-10-19(12-22(21)37-28(7,8)24(35)36)32-25-30-16-18(15-29)23(33-25)31-20-13-26(3,4)34(9)27(5,6)14-20/h10-12,16-17,20H,13-14H2,1-9H3,(H2,30,31,32,33) |
| InChIKey | VQEMRGRXNYVQIX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |