C32H42FN7O3 — CID 68665858
7-[2-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl]-4-(2-methoxyethyl)-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 68665858) has the molecular formula C32H42FN7O3 and a molecular weight of 591.73 g/mol. Its IUPAC name is 7-[2-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl]-4-(2-methoxyethyl)-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-[2-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl]-4-(2-methoxyethyl)-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 68665858 |
| Molecular Formula | C32H42FN7O3 |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | 7-[2-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]phenyl]-4-(2-methoxyethyl)-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COCCN1C(=O)C(C)(C)Oc2cc(-c3ccccc3Nc3ncc(F)c(NC4CC(C)(C)N(C)C(C)(C)C4)n3)cnc21 |
| InChI | InChI=1S/C32H42FN7O3/c1-30(2)16-21(17-31(3,4)39(30)7)36-26-23(33)19-35-29(38-26)37-24-12-10-9-11-22(24)20-15-25-27(34-18-20)40(13-14-42-8)28(41)32(5,6)43-25/h9-12,15,18-19,21H,13-14,16-17H2,1-8H3,(H2,35,36,37,38) |
| InChIKey | ZEPGMNIOBRHENA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |