C32H42N8O4 — CID 68666016
3-[2-[[4-(2-methoxyethyl)-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-7-yl]amino]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-5-yl]benzamide (PubChem CID 68666016) has the molecular formula C32H42N8O4 and a molecular weight of 602.74 g/mol. Its IUPAC name is 3-[2-[[4-(2-methoxyethyl)-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-7-yl]amino]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-5-yl]benzamide.
| Compound Name | 3-[2-[[4-(2-methoxyethyl)-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-7-yl]amino]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 68666016 |
| Molecular Formula | C32H42N8O4 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | 3-[2-[[4-(2-methoxyethyl)-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazin-7-yl]amino]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-5-yl]benzamide |
| SMILES | COCCN1C(=O)C(C)(C)Oc2cc(Nc3ncc(-c4cccc(C(N)=O)c4)c(NC4CC(C)(C)NC(C)(C)C4)n3)cnc21 |
| InChI | InChI=1S/C32H42N8O4/c1-30(2)15-22(16-31(3,4)39-30)36-26-23(19-9-8-10-20(13-19)25(33)41)18-35-29(38-26)37-21-14-24-27(34-17-21)40(11-12-43-7)28(42)32(5,6)44-24/h8-10,13-14,17-18,22,39H,11-12,15-16H2,1-7H3,(H2,33,41)(H2,35,36,37,38) |
| InChIKey | KDQBIUFGAFUSKP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 156.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |