C30H37F2N7O2 — CID 87535208
4-(2-fluoroethyl)-7-[[5-fluoro-4-phenyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 87535208) has the molecular formula C30H37F2N7O2 and a molecular weight of 565.67 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-7-[[5-fluoro-4-phenyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-(2-fluoroethyl)-7-[[5-fluoro-4-phenyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 87535208 |
| Molecular Formula | C30H37F2N7O2 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | 4-(2-fluoroethyl)-7-[[5-fluoro-4-phenyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC1(C)CC(Nc2nc(Nc3cnc4c(c3)OC(C)(C)C(=O)N4CCF)nc(-c3ccccc3)c2F)CC(C)(C)N1 |
| InChI | InChI=1S/C30H37F2N7O2/c1-28(2)15-20(16-29(3,4)38-28)34-24-22(32)23(18-10-8-7-9-11-18)36-27(37-24)35-19-14-21-25(33-17-19)39(13-12-31)26(40)30(5,6)41-21/h7-11,14,17,20,38H,12-13,15-16H2,1-6H3,(H2,34,35,36,37) |
| InChIKey | BWRXXJOYHYBUKQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |