C21H27FN8 — CID 46865948
5-fluoro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-[3-(1,2,4-triazol-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 46865948) has the molecular formula C21H27FN8 and a molecular weight of 410.50 g/mol. Its IUPAC name is 5-fluoro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-[3-(1,2,4-triazol-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-[3-(1,2,4-triazol-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 46865948 |
| Molecular Formula | C21H27FN8 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 5-fluoro-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-N-[3-(1,2,4-triazol-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2nc(Nc3cccc(-n4cncn4)c3)ncc2F)CC(C)(C)N1 |
| InChI | InChI=1S/C21H27FN8/c1-20(2)9-15(10-21(3,4)29-20)26-18-17(22)11-24-19(28-18)27-14-6-5-7-16(8-14)30-13-23-12-25-30/h5-8,11-13,15,29H,9-10H2,1-4H3,(H2,24,26,27,28) |
| InChIKey | VCWBGAFUAUNFPF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |