C24H35F2N7S — CID 89048685
5-fluoro-2-N-[3-(fluoromethyl)-4-(4-sulfanylpiperazin-1-yl)phenyl]-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 89048685) has the molecular formula C24H35F2N7S and a molecular weight of 491.66 g/mol. Its IUPAC name is 5-fluoro-2-N-[3-(fluoromethyl)-4-(4-sulfanylpiperazin-1-yl)phenyl]-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[3-(fluoromethyl)-4-(4-sulfanylpiperazin-1-yl)phenyl]-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89048685 |
| Molecular Formula | C24H35F2N7S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 5-fluoro-2-N-[3-(fluoromethyl)-4-(4-sulfanylpiperazin-1-yl)phenyl]-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2nc(Nc3ccc(N4CCN(S)CC4)c(CF)c3)ncc2F)CC(C)(C)N1 |
| InChI | InChI=1S/C24H35F2N7S/c1-23(2)12-18(13-24(3,4)31-23)28-21-19(26)15-27-22(30-21)29-17-5-6-20(16(11-17)14-25)32-7-9-33(34)10-8-32/h5-6,11,15,18,31,34H,7-10,12-14H2,1-4H3,(H2,27,28,29,30) |
| InChIKey | PEEIGDXNNOEORZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|