C31H37F4N7O2 — CID 25175963
7-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-6-phenylpyrimidin-2-yl]amino]-2,2-dimethyl-4-(2,2,2-trifluoroethyl)pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 25175963) has the molecular formula C31H37F4N7O2 and a molecular weight of 615.68 g/mol. Its IUPAC name is 7-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-6-phenylpyrimidin-2-yl]amino]-2,2-dimethyl-4-(2,2,2-trifluoroethyl)pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-6-phenylpyrimidin-2-yl]amino]-2,2-dimethyl-4-(2,2,2-trifluoroethyl)pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 25175963 |
| Molecular Formula | C31H37F4N7O2 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 7-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-6-phenylpyrimidin-2-yl]amino]-2,2-dimethyl-4-(2,2,2-trifluoroethyl)pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3cnc4c(c3)OC(C)(C)C(=O)N4CC(F)(F)F)nc(-c3ccccc3)c2F)CC1(C)C |
| InChI | InChI=1S/C31H37F4N7O2/c1-28(2)14-20(15-29(3,4)41(28)7)37-24-22(32)23(18-11-9-8-10-12-18)39-27(40-24)38-19-13-21-25(36-16-19)42(17-31(33,34)35)26(43)30(5,6)44-21/h8-13,16,20H,14-15,17H2,1-7H3,(H2,37,38,39,40) |
| InChIKey | IINNUNPDKORCPQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |