C25H35FN6O2 — CID 46865859
7-[[4-amino-5-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-2-yl]amino]-4-(2-fluoroethyl)-2,2-dimethyl-1,4-benzoxazin-3-one (PubChem CID 46865859) has the molecular formula C25H35FN6O2 and a molecular weight of 470.59 g/mol. Its IUPAC name is 7-[[4-amino-5-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-2-yl]amino]-4-(2-fluoroethyl)-2,2-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 7-[[4-amino-5-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-2-yl]amino]-4-(2-fluoroethyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46865859 |
| Molecular Formula | C25H35FN6O2 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 7-[[4-amino-5-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-2-yl]amino]-4-(2-fluoroethyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CC1(C)CC(c2cnc(Nc3ccc4c(c3)OC(C)(C)C(=O)N4CCF)nc2N)CC(C)(C)N1 |
| InChI | InChI=1S/C25H35FN6O2/c1-23(2)12-15(13-24(3,4)31-23)17-14-28-22(30-20(17)27)29-16-7-8-18-19(11-16)34-25(5,6)21(33)32(18)10-9-26/h7-8,11,14-15,31H,9-10,12-13H2,1-6H3,(H3,27,28,29,30) |
| InChIKey | CSQNDGWRHBSMOM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |