C21H24N6O2 — CID 118376159
4-amino-7-[[4-(cyclobutylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]-2,2-dimethyl-1,4-benzoxazin-3-one (PubChem CID 118376159) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-amino-7-[[4-(cyclobutylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]-2,2-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 4-amino-7-[[4-(cyclobutylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]-2,2-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 118376159 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 4-amino-7-[[4-(cyclobutylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]-2,2-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2cc(Nc3nc(CC4CCC4)c4cc[nH]c4n3)ccc2N(N)C1=O |
| InChI | InChI=1S/C21H24N6O2/c1-21(2)19(28)27(22)16-7-6-13(11-17(16)29-21)24-20-25-15(10-12-4-3-5-12)14-8-9-23-18(14)26-20/h6-9,11-12H,3-5,10,22H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | JEGOFFOERITYAZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|