C24H31N5O3 — CID 175313511
8-cyclopentyl-2-[4-(4-hydroxypiperidin-1-yl)anilino]-6,6-dimethylpyrimido[5,4-b][1,4]oxazin-7-one (PubChem CID 175313511) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 8-cyclopentyl-2-[4-(4-hydroxypiperidin-1-yl)anilino]-6,6-dimethylpyrimido[5,4-b][1,4]oxazin-7-one.
| Compound Name | 8-cyclopentyl-2-[4-(4-hydroxypiperidin-1-yl)anilino]-6,6-dimethylpyrimido[5,4-b][1,4]oxazin-7-one |
|---|---|
| PubChem CID | 175313511 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 8-cyclopentyl-2-[4-(4-hydroxypiperidin-1-yl)anilino]-6,6-dimethylpyrimido[5,4-b][1,4]oxazin-7-one |
| SMILES | CC1(C)Oc2cnc(Nc3ccc(N4CCC(O)CC4)cc3)nc2N(C2CCCC2)C1=O |
| InChI | InChI=1S/C24H31N5O3/c1-24(2)22(31)29(18-5-3-4-6-18)21-20(32-24)15-25-23(27-21)26-16-7-9-17(10-8-16)28-13-11-19(30)12-14-28/h7-10,15,18-19,30H,3-6,11-14H2,1-2H3,(H,25,26,27) |
| InChIKey | PAYAWRSPQRIUOC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|