C27H33F3N6O4 — CID 174297087
2-[4-(4-acetylpiperazin-1-yl)-2-(2,2,2-trifluoroethoxy)anilino]-8-cyclopentyl-6,6-dimethylpyrimido[5,4-b][1,4]oxazin-7-one (PubChem CID 174297087) has the molecular formula C27H33F3N6O4 and a molecular weight of 562.59 g/mol. Its IUPAC name is 2-[4-(4-acetylpiperazin-1-yl)-2-(2,2,2-trifluoroethoxy)anilino]-8-cyclopentyl-6,6-dimethylpyrimido[5,4-b][1,4]oxazin-7-one.
| Compound Name | 2-[4-(4-acetylpiperazin-1-yl)-2-(2,2,2-trifluoroethoxy)anilino]-8-cyclopentyl-6,6-dimethylpyrimido[5,4-b][1,4]oxazin-7-one |
|---|---|
| PubChem CID | 174297087 |
| Molecular Formula | C27H33F3N6O4 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 2-[4-(4-acetylpiperazin-1-yl)-2-(2,2,2-trifluoroethoxy)anilino]-8-cyclopentyl-6,6-dimethylpyrimido[5,4-b][1,4]oxazin-7-one |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3ncc4c(n3)N(C3CCCC3)C(=O)C(C)(C)O4)c(OCC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H33F3N6O4/c1-17(37)34-10-12-35(13-11-34)19-8-9-20(21(14-19)39-16-27(28,29)30)32-25-31-15-22-23(33-25)36(18-6-4-5-7-18)24(38)26(2,3)40-22/h8-9,14-15,18H,4-7,10-13,16H2,1-3H3,(H,31,32,33) |
| InChIKey | MOKIHWKMPLFDIJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |