C25H34FN7O — CID 162351821
8-[2-[4-(4-ethylpiperazin-1-yl)-3-fluoroanilino]-5-methylpyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 162351821) has the molecular formula C25H34FN7O and a molecular weight of 467.59 g/mol. Its IUPAC name is 8-[2-[4-(4-ethylpiperazin-1-yl)-3-fluoroanilino]-5-methylpyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-[2-[4-(4-ethylpiperazin-1-yl)-3-fluoroanilino]-5-methylpyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 162351821 |
| Molecular Formula | C25H34FN7O |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 8-[2-[4-(4-ethylpiperazin-1-yl)-3-fluoroanilino]-5-methylpyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | CCN1CCN(c2ccc(Nc3ncc(C)c(N4CCC5(CCNC5=O)CC4)n3)cc2F)CC1 |
| InChI | InChI=1S/C25H34FN7O/c1-3-31-12-14-32(15-13-31)21-5-4-19(16-20(21)26)29-24-28-17-18(2)22(30-24)33-10-7-25(8-11-33)6-9-27-23(25)34/h4-5,16-17H,3,6-15H2,1-2H3,(H,27,34)(H,28,29,30) |
| InChIKey | YEBPXBMDAZDRIP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|